C18H25F7N2O7 — CID 58939457
2-[bis(carboxymethyl)amino]-6-(6,6,7,7,8,8,8-heptafluorooctanoylamino)hexanoic acid (PubChem CID 58939457) has the molecular formula C18H25F7N2O7 and a molecular weight of 514.39 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-(6,6,7,7,8,8,8-heptafluorooctanoylamino)hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-(6,6,7,7,8,8,8-heptafluorooctanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 58939457 |
| Molecular Formula | C18H25F7N2O7 |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-(6,6,7,7,8,8,8-heptafluorooctanoylamino)hexanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCCNC(=O)CCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H25F7N2O7/c19-16(20,17(21,22)18(23,24)25)7-3-1-6-12(28)26-8-4-2-5-11(15(33)34)27(9-13(29)30)10-14(31)32/h11H,1-10H2,(H,26,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | XBFDLKRMXGWKKY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|