C26H42N4O14 — CID 102163683
2-[bis(carboxymethyl)amino]-6-[[6-[[5-[bis(carboxymethyl)amino]-5-carboxypentyl]amino]-6-oxohexanoyl]amino]hexanoic acid (PubChem CID 102163683) has the molecular formula C26H42N4O14 and a molecular weight of 634.64 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[[6-[[5-[bis(carboxymethyl)amino]-5-carboxypentyl]amino]-6-oxohexanoyl]amino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[[6-[[5-[bis(carboxymethyl)amino]-5-carboxypentyl]amino]-6-oxohexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 102163683 |
| Molecular Formula | C26H42N4O14 |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[[6-[[5-[bis(carboxymethyl)amino]-5-carboxypentyl]amino]-6-oxohexanoyl]amino]hexanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCCNC(=O)CCCCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H42N4O14/c31-19(27-11-5-3-7-17(25(41)42)29(13-21(33)34)14-22(35)36)9-1-2-10-20(32)28-12-6-4-8-18(26(43)44)30(15-23(37)38)16-24(39)40/h17-18H,1-16H2,(H,27,31)(H,28,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | SOOLKNQSQGUUDW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 288.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|