C28H46N4O14S2 — CID 10462628
3-[bis(carboxymethyl)amino]-7-[3-[[3-[[5-[bis(carboxymethyl)amino]-6-carboxyhexyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]heptanoic acid (PubChem CID 10462628) has the molecular formula C28H46N4O14S2 and a molecular weight of 726.82 g/mol. Its IUPAC name is 3-[bis(carboxymethyl)amino]-7-[3-[[3-[[5-[bis(carboxymethyl)amino]-6-carboxyhexyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]heptanoic acid.
| Compound Name | 3-[bis(carboxymethyl)amino]-7-[3-[[3-[[5-[bis(carboxymethyl)amino]-6-carboxyhexyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]heptanoic acid |
|---|---|
| PubChem CID | 10462628 |
| Molecular Formula | C28H46N4O14S2 |
| Molecular Weight | 726.82 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | 3-[bis(carboxymethyl)amino]-7-[3-[[3-[[5-[bis(carboxymethyl)amino]-6-carboxyhexyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]heptanoic acid |
| SMILES | O=C(O)CC(CCCCNC(=O)CCSSCCC(=O)NCCCCC(CC(=O)O)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C28H46N4O14S2/c33-21(29-9-3-1-5-19(13-23(35)36)31(15-25(39)40)16-26(41)42)7-11-47-48-12-8-22(34)30-10-4-2-6-20(14-24(37)38)32(17-27(43)44)18-28(45)46/h19-20H,1-18H2,(H,29,33)(H,30,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | JWCSDJIWEGJMAL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 288.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.82 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|