C21H34N4O7S — CID 89279703
2-[bis(carboxymethyl)amino]-6-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid (PubChem CID 89279703) has the molecular formula C21H34N4O7S and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 89279703 |
| Molecular Formula | C21H34N4O7S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid |
| SMILES | C=C1NC2CSC(CCCCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)C2N1 |
| InChI | InChI=1S/C21H34N4O7S/c1-13-23-14-12-33-16(20(14)24-13)7-2-3-8-17(26)22-9-5-4-6-15(21(31)32)25(10-18(27)28)11-19(29)30/h14-16,20,23-24H,1-12H2,(H,22,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | JEGVDHMBCOOAED-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|