C25H43N3O8 — CID 89247399
2-[bis(carboxymethyl)amino]-6-[3-[(2-methylprop-2-enoylamino)methyl]decanoylamino]hexanoic acid (PubChem CID 89247399) has the molecular formula C25H43N3O8 and a molecular weight of 513.63 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[3-[(2-methylprop-2-enoylamino)methyl]decanoylamino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[3-[(2-methylprop-2-enoylamino)methyl]decanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 89247399 |
| Molecular Formula | C25H43N3O8 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[3-[(2-methylprop-2-enoylamino)methyl]decanoylamino]hexanoic acid |
| SMILES | C=C(C)C(=O)NCC(CCCCCCC)CC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C25H43N3O8/c1-4-5-6-7-8-11-19(15-27-24(34)18(2)3)14-21(29)26-13-10-9-12-20(25(35)36)28(16-22(30)31)17-23(32)33/h19-20H,2,4-17H2,1,3H3,(H,26,29)(H,27,34)(H,30,31)(H,32,33)(H,35,36) |
| InChIKey | FEPVIYULWNQTOC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|