C9H13CuNO8+2 — CID 91664372
copper 2-[bis(carboxymethyl)amino]pentanedioic acid (PubChem CID 91664372) has the molecular formula C9H13CuNO8+2 and a molecular weight of 326.75 g/mol. Its IUPAC name is copper 2-[bis(carboxymethyl)amino]pentanedioic acid.
| Compound Name | copper 2-[bis(carboxymethyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 91664372 |
| Molecular Formula | C9H13CuNO8+2 |
| Molecular Weight | 326.75 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | copper 2-[bis(carboxymethyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N(CC(=O)O)CC(=O)O.[Cu+2] |
| InChI | InChI=1S/C9H13NO8.Cu/c11-6(12)2-1-5(9(17)18)10(3-7(13)14)4-8(15)16;/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18);/q;+2 |
| InChIKey | APEDNCSWAYVZKB-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.75 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |