C9H15NO8 — CID 59941977
2-[bis(carboxymethyl)amino]-5-hydroperoxypentanoic acid (PubChem CID 59941977) has the molecular formula C9H15NO8 and a molecular weight of 265.22 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-5-hydroperoxypentanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-5-hydroperoxypentanoic acid |
|---|---|
| PubChem CID | 59941977 |
| Molecular Formula | C9H15NO8 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-5-hydroperoxypentanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCOO)C(=O)O |
| InChI | InChI=1S/C9H15NO8/c11-7(12)4-10(5-8(13)14)6(9(15)16)2-1-3-18-17/h6,17H,1-5H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | XUDQCFZECJXABY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|