C8H12ClNO6 — CID 123429639
2-[bis(carboxymethyl)amino]-4-chlorobutanoic acid (PubChem CID 123429639) has the molecular formula C8H12ClNO6 and a molecular weight of 253.64 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-4-chlorobutanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-4-chlorobutanoic acid |
|---|---|
| PubChem CID | 123429639 |
| Molecular Formula | C8H12ClNO6 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-4-chlorobutanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCl)C(=O)O |
| InChI | InChI=1S/C8H12ClNO6/c9-2-1-5(8(15)16)10(3-6(11)12)4-7(13)14/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | GZONOVLZNGFBMT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|