C33H42N6O6S — CID 136617435
N-[6-[2-ethyl-5-hydroxy-4-(1-methylpyrazol-3-yl)phenoxy]-2,2-dimethylhexyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide (PubChem CID 136617435) has the molecular formula C33H42N6O6S and a molecular weight of 650.80 g/mol. Its IUPAC name is N-[6-[2-ethyl-5-hydroxy-4-(1-methylpyrazol-3-yl)phenoxy]-2,2-dimethylhexyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide.
| Compound Name | N-[6-[2-ethyl-5-hydroxy-4-(1-methylpyrazol-3-yl)phenoxy]-2,2-dimethylhexyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136617435 |
| Molecular Formula | C33H42N6O6S |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | N-[6-[2-ethyl-5-hydroxy-4-(1-methylpyrazol-3-yl)phenoxy]-2,2-dimethylhexyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(-c2ccn(C)n2)c(O)cc1OCCCCC(C)(C)CNC(=O)c1ccc(/N=N/Cc2ccccc2S(O)(O)O)nc1 |
| InChI | InChI=1S/C33H42N6O6S/c1-5-23-18-26(27-14-16-39(4)38-27)28(40)19-29(23)45-17-9-8-15-33(2,3)22-35-32(41)25-12-13-31(34-20-25)37-36-21-24-10-6-7-11-30(24)46(42,43)44/h6-7,10-14,16,18-20,40,42-44H,5,8-9,15,17,21-22H2,1-4H3,(H,35,41)/b37-36+ |
| InChIKey | VRKPORDSYKHPGK-BSRQYYOTSA-N |
| XLogP | 7.62 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|