C31H31FN4O5S — CID 59078124
N-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butyl]-6-[(2E)-2-[(2-hydroperoxysulfanylphenyl)methylidene]hydrazinyl]pyridine-3-carboxamide (PubChem CID 59078124) has the molecular formula C31H31FN4O5S and a molecular weight of 590.68 g/mol. Its IUPAC name is N-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butyl]-6-[(2E)-2-[(2-hydroperoxysulfanylphenyl)methylidene]hydrazinyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butyl]-6-[(2E)-2-[(2-hydroperoxysulfanylphenyl)methylidene]hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59078124 |
| Molecular Formula | C31H31FN4O5S |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | N-[4-[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]butyl]-6-[(2E)-2-[(2-hydroperoxysulfanylphenyl)methylidene]hydrazinyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCCCCNC(=O)c1ccc(N/N=C/c2ccccc2SOO)nc1 |
| InChI | InChI=1S/C31H31FN4O5S/c1-2-21-17-26(22-9-12-25(32)13-10-22)27(37)18-28(21)40-16-6-5-15-33-31(38)24-11-14-30(34-19-24)36-35-20-23-7-3-4-8-29(23)42-41-39/h3-4,7-14,17-20,37,39H,2,5-6,15-16H2,1H3,(H,33,38)(H,34,36)/b35-20+ |
| InChIKey | MNXLJZGFHXJIFN-JEPNHJGPSA-N |
| XLogP | 6.69 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|