C30H35N5O9S — CID 22089134
3-[2-methoxy-6-[4-oxo-4-[3-[[6-[(2E)-2-[[2-(trioxidanylsulfanyl)phenyl]methylidene]hydrazinyl]pyridine-3-carbonyl]amino]propylamino]butoxy]phenyl]propanoic acid (PubChem CID 22089134) has the molecular formula C30H35N5O9S and a molecular weight of 641.70 g/mol. Its IUPAC name is 3-[2-methoxy-6-[4-oxo-4-[3-[[6-[(2E)-2-[[2-(trioxidanylsulfanyl)phenyl]methylidene]hydrazinyl]pyridine-3-carbonyl]amino]propylamino]butoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-methoxy-6-[4-oxo-4-[3-[[6-[(2E)-2-[[2-(trioxidanylsulfanyl)phenyl]methylidene]hydrazinyl]pyridine-3-carbonyl]amino]propylamino]butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22089134 |
| Molecular Formula | C30H35N5O9S |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 3-[2-methoxy-6-[4-oxo-4-[3-[[6-[(2E)-2-[[2-(trioxidanylsulfanyl)phenyl]methylidene]hydrazinyl]pyridine-3-carbonyl]amino]propylamino]butoxy]phenyl]propanoic acid |
| SMILES | COc1cccc(OCCCC(=O)NCCCNC(=O)c2ccc(N/N=C/c3ccccc3SOOO)nc2)c1CCC(=O)O |
| InChI | InChI=1S/C30H35N5O9S/c1-41-24-8-4-9-25(23(24)13-15-29(37)38)42-18-5-11-28(36)31-16-6-17-32-30(39)22-12-14-27(33-19-22)35-34-20-21-7-2-3-10-26(21)45-44-43-40/h2-4,7-10,12,14,19-20,40H,5-6,11,13,15-18H2,1H3,(H,31,36)(H,32,39)(H,33,35)(H,37,38)/b34-20+ |
| InChIKey | QPLNLELVOISAPV-QXUDOOCXSA-N |
| XLogP | 4.08 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|