C22H23N3O3 — CID 143178920
ethane;3-[6-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-3-pyridinyl]benzoic acid (PubChem CID 143178920) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethane;3-[6-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-3-pyridinyl]benzoic acid.
| Compound Name | ethane;3-[6-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 143178920 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | ethane;3-[6-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-3-pyridinyl]benzoic acid |
| SMILES | CC.COc1ccccc1/C=N/Nc1ccc(-c2cccc(C(=O)O)c2)cn1 |
| InChI | InChI=1S/C20H17N3O3.C2H6/c1-26-18-8-3-2-5-17(18)13-22-23-19-10-9-16(12-21-19)14-6-4-7-15(11-14)20(24)25;1-2/h2-13H,1H3,(H,21,23)(H,24,25);1-2H3/b22-13+; |
| InChIKey | PEDBOCGUAJUDTO-PNAHYYPNSA-N |
| XLogP | 4.93 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|