C23H24N6O4 — CID 143178939
[3-[6-[(2E)-2-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydrazinyl]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 143178939) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is [3-[6-[(2E)-2-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydrazinyl]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-[6-[(2E)-2-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydrazinyl]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 143178939 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [3-[6-[(2E)-2-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydrazinyl]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | COc1ncc(/C=N/Nc2ccc(-c3cccc(C(=O)N4CCOCC4)c3)cn2)c(OC)n1 |
| InChI | InChI=1S/C23H24N6O4/c1-31-21-19(14-25-23(27-21)32-2)15-26-28-20-7-6-18(13-24-20)16-4-3-5-17(12-16)22(30)29-8-10-33-11-9-29/h3-7,12-15H,8-11H2,1-2H3,(H,24,28)/b26-15+ |
| InChIKey | ASVLPSIUQWRUJQ-CVKSISIWSA-N |
| XLogP | 2.47 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|