C26H24IN3O4S — CID 143540455
[3-(2,6-dimethoxyphenyl)-5-[3-(morpholine-4-carbonyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 143540455) has the molecular formula C26H24IN3O4S and a molecular weight of 601.47 g/mol. Its IUPAC name is [3-(2,6-dimethoxyphenyl)-5-[3-(morpholine-4-carbonyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
| Compound Name | [3-(2,6-dimethoxyphenyl)-5-[3-(morpholine-4-carbonyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 143540455 |
| Molecular Formula | C26H24IN3O4S |
| Molecular Weight | 601.47 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | [3-(2,6-dimethoxyphenyl)-5-[3-(morpholine-4-carbonyl)phenyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | COc1cccc(OC)c1-c1cn(SI)c2ncc(-c3cccc(C(=O)N4CCOCC4)c3)cc12 |
| InChI | InChI=1S/C26H24IN3O4S/c1-32-22-7-4-8-23(33-2)24(22)21-16-30(35-27)25-20(21)14-19(15-28-25)17-5-3-6-18(13-17)26(31)29-9-11-34-12-10-29/h3-8,13-16H,9-12H2,1-2H3 |
| InChIKey | YRNFGEOKROZMES-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|