C23H20FIN4O2S — CID 145491933
[5-[4-amino-3-(dimethylcarbamoyl)-5-fluorophenyl]-3-(2-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 145491933) has the molecular formula C23H20FIN4O2S and a molecular weight of 562.41 g/mol. Its IUPAC name is [5-[4-amino-3-(dimethylcarbamoyl)-5-fluorophenyl]-3-(2-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
| Compound Name | [5-[4-amino-3-(dimethylcarbamoyl)-5-fluorophenyl]-3-(2-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 145491933 |
| Molecular Formula | C23H20FIN4O2S |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | [5-[4-amino-3-(dimethylcarbamoyl)-5-fluorophenyl]-3-(2-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | COc1ccccc1-c1cn(SI)c2ncc(-c3cc(F)c(N)c(C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C23H20FIN4O2S/c1-28(2)23(30)17-8-13(10-19(24)21(17)26)14-9-16-18(12-29(32-25)22(16)27-11-14)15-6-4-5-7-20(15)31-3/h4-12H,26H2,1-3H3 |
| InChIKey | FOLLYFDBWXWENG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|