C27H29Cl2N3O2 — CID 143178848
[3-[6-[[(1E,3E,5E,7E)-6,8-dichloro-2-ethylnona-1,3,5,7-tetraenyl]amino]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 143178848) has the molecular formula C27H29Cl2N3O2 and a molecular weight of 498.45 g/mol. Its IUPAC name is [3-[6-[[(1E,3E,5E,7E)-6,8-dichloro-2-ethylnona-1,3,5,7-tetraenyl]amino]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-[6-[[(1E,3E,5E,7E)-6,8-dichloro-2-ethylnona-1,3,5,7-tetraenyl]amino]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 143178848 |
| Molecular Formula | C27H29Cl2N3O2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [3-[6-[[(1E,3E,5E,7E)-6,8-dichloro-2-ethylnona-1,3,5,7-tetraenyl]amino]-3-pyridinyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | CCC(/C=C/C=C(Cl)\C=C(/C)Cl)=C\Nc1ccc(-c2cccc(C(=O)N3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C27H29Cl2N3O2/c1-3-21(6-4-9-25(29)16-20(2)28)18-30-26-11-10-24(19-31-26)22-7-5-8-23(17-22)27(33)32-12-14-34-15-13-32/h4-11,16-19H,3,12-15H2,1-2H3,(H,30,31)/b6-4+,20-16+,21-18+,25-9+ |
| InChIKey | FFFPALHQYSWVAO-PFOXONFNSA-N |
| XLogP | 6.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|