C16H16N2O4 — CID 5136185
2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 5136185) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 5136185 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cccc(C=NNc2ccccc2C(=O)O)c1OC |
| InChI | InChI=1S/C16H16N2O4/c1-21-14-9-5-6-11(15(14)22-2)10-17-18-13-8-4-3-7-12(13)16(19)20/h3-10,18H,1-2H3,(H,19,20) |
| InChIKey | FRTOZJJLXZVIBT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|