C15H13N2O4- — CID 135708289
2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]-6-methoxyphenolate (PubChem CID 135708289) has the molecular formula C15H13N2O4- and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]-6-methoxyphenolate.
| Compound Name | 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 135708289 |
| Molecular Formula | C15H13N2O4- |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]-6-methoxyphenolate |
| SMILES | COc1cccc(/C=N/Nc2ccccc2C(=O)O)c1[O-] |
| InChI | InChI=1S/C15H14N2O4/c1-21-13-8-4-5-10(14(13)18)9-16-17-12-7-3-2-6-11(12)15(19)20/h2-9,17-18H,1H3,(H,19,20)/p-1/b16-9+ |
| InChIKey | FQBRUNFXUVATIF-CXUHLZMHSA-M |
| XLogP | 1.91 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|