C14H11N2O5S- — CID 142408404
2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]benzenesulfonate (PubChem CID 142408404) has the molecular formula C14H11N2O5S- and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]benzenesulfonate.
| Compound Name | 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 142408404 |
| Molecular Formula | C14H11N2O5S- |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[(E)-[(2-carboxyphenyl)hydrazinylidene]methyl]benzenesulfonate |
| SMILES | O=C(O)c1ccccc1N/N=C/c1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C14H12N2O5S/c17-14(18)11-6-2-3-7-12(11)16-15-9-10-5-1-4-8-13(10)22(19,20)21/h1-9,16H,(H,17,18)(H,19,20,21)/p-1/b15-9+ |
| InChIKey | CGONDMAZLKEYIK-OQLLNIDSSA-M |
| XLogP | 1.73 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|