C32H42O8 — CID 70281373
4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-2-prop-2-enyl-3,6,7,8-tetrahydro-2H-naphthalen-1-yl)oxy]pentoxy]phenoxy]butanoic acid (PubChem CID 70281373) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-2-prop-2-enyl-3,6,7,8-tetrahydro-2H-naphthalen-1-yl)oxy]pentoxy]phenoxy]butanoic acid.
| Compound Name | 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-2-prop-2-enyl-3,6,7,8-tetrahydro-2H-naphthalen-1-yl)oxy]pentoxy]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 70281373 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-2-prop-2-enyl-3,6,7,8-tetrahydro-2H-naphthalen-1-yl)oxy]pentoxy]phenoxy]butanoic acid |
| SMILES | C=CCC1CC=C2C(=O)CCCC2=C1OCCCCCOc1cccc(OCCCC(=O)O)c1CCC(=O)OC |
| InChI | InChI=1S/C32H42O8/c1-3-10-23-16-17-24-25(11-7-12-27(24)33)32(23)40-21-6-4-5-20-38-28-13-8-14-29(39-22-9-15-30(34)35)26(28)18-19-31(36)37-2/h3,8,13-14,17,23H,1,4-7,9-12,15-16,18-22H2,2H3,(H,34,35) |
| InChIKey | AUXJGAGATUDBTQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|