C26H42O8S — CID 19922050
3-[2-(9-methoxy-9-oxononoxy)-6-(6-methylsulfonyloxyhexyl)phenyl]propanoic acid (PubChem CID 19922050) has the molecular formula C26H42O8S and a molecular weight of 514.68 g/mol. Its IUPAC name is 3-[2-(9-methoxy-9-oxononoxy)-6-(6-methylsulfonyloxyhexyl)phenyl]propanoic acid.
| Compound Name | 3-[2-(9-methoxy-9-oxononoxy)-6-(6-methylsulfonyloxyhexyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19922050 |
| Molecular Formula | C26H42O8S |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-[2-(9-methoxy-9-oxononoxy)-6-(6-methylsulfonyloxyhexyl)phenyl]propanoic acid |
| SMILES | COC(=O)CCCCCCCCOc1cccc(CCCCCCOS(C)(=O)=O)c1CCC(=O)O |
| InChI | InChI=1S/C26H42O8S/c1-32-26(29)17-10-5-3-4-7-11-20-33-24-16-13-15-22(23(24)18-19-25(27)28)14-9-6-8-12-21-34-35(2,30)31/h13,15-16H,3-12,14,17-21H2,1-2H3,(H,27,28) |
| InChIKey | ZUAVFTZUFPKFIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|