C23H36O9S — CID 14330011
methyl 6-[4-acetyl-3-[2-(2-methylsulfonyloxyethoxy)ethoxy]-2-propylphenoxy]hexanoate (PubChem CID 14330011) has the molecular formula C23H36O9S and a molecular weight of 488.60 g/mol. Its IUPAC name is methyl 6-[4-acetyl-3-[2-(2-methylsulfonyloxyethoxy)ethoxy]-2-propylphenoxy]hexanoate.
| Compound Name | methyl 6-[4-acetyl-3-[2-(2-methylsulfonyloxyethoxy)ethoxy]-2-propylphenoxy]hexanoate |
|---|---|
| PubChem CID | 14330011 |
| Molecular Formula | C23H36O9S |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | methyl 6-[4-acetyl-3-[2-(2-methylsulfonyloxyethoxy)ethoxy]-2-propylphenoxy]hexanoate |
| SMILES | CCCc1c(OCCCCCC(=O)OC)ccc(C(C)=O)c1OCCOCCOS(C)(=O)=O |
| InChI | InChI=1S/C23H36O9S/c1-5-9-20-21(30-13-8-6-7-10-22(25)28-3)12-11-19(18(2)24)23(20)31-16-14-29-15-17-32-33(4,26)27/h11-12H,5-10,13-17H2,1-4H3 |
| InChIKey | DNIBXCRQZRPIOI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|