C20H30O9S — CID 19922034
3-[4-(4-methoxy-4-oxobutoxy)-2-(5-methylsulfonyloxypentoxy)phenyl]propanoic acid (PubChem CID 19922034) has the molecular formula C20H30O9S and a molecular weight of 446.52 g/mol. Its IUPAC name is 3-[4-(4-methoxy-4-oxobutoxy)-2-(5-methylsulfonyloxypentoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-(4-methoxy-4-oxobutoxy)-2-(5-methylsulfonyloxypentoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19922034 |
| Molecular Formula | C20H30O9S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-[4-(4-methoxy-4-oxobutoxy)-2-(5-methylsulfonyloxypentoxy)phenyl]propanoic acid |
| SMILES | COC(=O)CCCOc1ccc(CCC(=O)O)c(OCCCCCOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H30O9S/c1-26-20(23)7-6-13-27-17-10-8-16(9-11-19(21)22)18(15-17)28-12-4-3-5-14-29-30(2,24)25/h8,10,15H,3-7,9,11-14H2,1-2H3,(H,21,22) |
| InChIKey | FNPPKJUFUXHFRQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|