C38H43NO6 — CID 54160555
methyl 4-[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate (PubChem CID 54160555) has the molecular formula C38H43NO6 and a molecular weight of 609.76 g/mol. Its IUPAC name is methyl 4-[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate.
| Compound Name | methyl 4-[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 54160555 |
| Molecular Formula | C38H43NO6 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | methyl 4-[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1CCC(=O)OC |
| InChI | InChI=1S/C38H43NO6/c1-42-37(40)22-14-26-44-35-21-13-20-30(33(35)23-24-38(41)43-2)17-7-3-4-12-25-45-36-28-32(29-15-8-5-9-16-29)27-34(39-36)31-18-10-6-11-19-31/h5-6,8-11,13,15-16,18-21,27-28H,3-4,7,12,14,17,22-26H2,1-2H3 |
| InChIKey | OOCBVLLEAHGQAX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|