C42H43NO6 — CID 54315009
methyl 3-[[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]methyl]benzoate (PubChem CID 54315009) has the molecular formula C42H43NO6 and a molecular weight of 657.81 g/mol. Its IUPAC name is methyl 3-[[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 54315009 |
| Molecular Formula | C42H43NO6 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | methyl 3-[[3-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexyl]-2-(3-methoxy-3-oxopropyl)phenoxy]methyl]benzoate |
| SMILES | COC(=O)CCc1c(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)cccc1OCc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C42H43NO6/c1-46-41(44)25-24-37-33(21-14-23-39(37)49-30-31-15-13-22-35(27-31)42(45)47-2)18-7-3-4-12-26-48-40-29-36(32-16-8-5-9-17-32)28-38(43-40)34-19-10-6-11-20-34/h5-6,8-11,13-17,19-23,27-29H,3-4,7,12,18,24-26,30H2,1-2H3 |
| InChIKey | SNODKDYFTOJMGV-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|