C48H66N4O10 — CID 59078034
6-[4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-propylphenoxy]butanoylamino]-2-(methylamino)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide (PubChem CID 59078034) has the molecular formula C48H66N4O10 and a molecular weight of 859.07 g/mol. Its IUPAC name is 6-[4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-propylphenoxy]butanoylamino]-2-(methylamino)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide.
| Compound Name | 6-[4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-propylphenoxy]butanoylamino]-2-(methylamino)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 59078034 |
| Molecular Formula | C48H66N4O10 |
| Molecular Weight | 859.07 g/mol |
| Exact Mass | 858.48 |
| IUPAC Name | 6-[4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-propylphenoxy]butanoylamino]-2-(methylamino)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
| SMILES | CCCc1c(OCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)cccc1OCCCC(=O)NCCCCC(NC)C(=O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C48H66N4O10/c1-3-17-37-42(60-27-13-6-14-28-62-45-31-36(34-18-7-4-8-19-34)30-39(52-45)35-20-9-5-10-21-35)23-15-24-43(37)61-29-16-25-44(56)50-26-12-11-22-38(49-2)48(59)51-32-40(54)46(57)47(58)41(55)33-53/h4-5,7-10,15,18-21,23-24,30-31,38,40-41,46-47,49,53-55,57-58H,3,6,11-14,16-17,22,25-29,32-33H2,1-2H3,(H,50,56)(H,51,59) |
| InChIKey | SNEREOTYUSXSOM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 211.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|