C20H27NO4 — CID 56984836
tert-butyl 2-amino-3-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoate (PubChem CID 56984836) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-amino-3-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 56984836 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl 2-amino-3-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propanoate |
| SMILES | C=CCc1c(OCC(N)C(=O)OC(C)(C)C)ccc2c1CCCC2=O |
| InChI | InChI=1S/C20H27NO4/c1-5-7-15-13-8-6-9-17(22)14(13)10-11-18(15)24-12-16(21)19(23)25-20(2,3)4/h5,10-11,16H,1,6-9,12,21H2,2-4H3 |
| InChIKey | LGLHKGHMMZZVES-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|