C27H26F3N3O5 — CID 22089101
2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 22089101) has the molecular formula C27H26F3N3O5 and a molecular weight of 529.52 g/mol. Its IUPAC name is 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-2-[(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 22089101 |
| Molecular Formula | C27H26F3N3O5 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | O=C(CCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)NC(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C27H26F3N3O5/c28-27(29,30)26(37)33-24(25(35)36)32-22(34)14-8-3-9-15-38-23-17-20(18-10-4-1-5-11-18)16-21(31-23)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17,24H,3,8-9,14-15H2,(H,32,34)(H,33,37)(H,35,36) |
| InChIKey | QGUPEJFRZHORMG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|