C25H29FN2O — CID 22089163
6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-amine (PubChem CID 22089163) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-amine.
| Compound Name | 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 22089163 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCOc1cc(-c2ccccc2)cc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H29FN2O/c1-25(2,18-27)14-6-7-15-29-24-17-21(19-8-4-3-5-9-19)16-23(28-24)20-10-12-22(26)13-11-20/h3-5,8-13,16-17H,6-7,14-15,18,27H2,1-2H3 |
| InChIKey | MLFIIXSBBCJAKR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|