C25H31N5O — CID 78172902
2-[5-methyl-5-(tetrazolidin-5-yl)hexoxy]-4,6-diphenylpyridine (PubChem CID 78172902) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[5-methyl-5-(tetrazolidin-5-yl)hexoxy]-4,6-diphenylpyridine.
| Compound Name | 2-[5-methyl-5-(tetrazolidin-5-yl)hexoxy]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 78172902 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-[5-methyl-5-(tetrazolidin-5-yl)hexoxy]-4,6-diphenylpyridine |
| SMILES | CC(C)(CCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)C1NNNN1 |
| InChI | InChI=1S/C25H31N5O/c1-25(2,24-27-29-30-28-24)15-9-10-16-31-23-18-21(19-11-5-3-6-12-19)17-22(26-23)20-13-7-4-8-14-20/h3-8,11-14,17-18,24,27-30H,9-10,15-16H2,1-2H3 |
| InChIKey | NXHJNKPYZHRKTA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|