C42H38N4O6P2+2 — CID 121289801
2-[4-[4-[2-phenyl-6-[4-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]phenyl]pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 121289801) has the molecular formula C42H38N4O6P2+2 and a molecular weight of 756.74 g/mol. Its IUPAC name is 2-[4-[4-[2-phenyl-6-[4-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]phenyl]pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | 2-[4-[4-[2-phenyl-6-[4-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]phenyl]pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 121289801 |
| Molecular Formula | C42H38N4O6P2+2 |
| Molecular Weight | 756.74 g/mol |
| Exact Mass | 756.23 |
| IUPAC Name | 2-[4-[4-[2-phenyl-6-[4-[4-[1-(2-phosphonoethyl)pyridin-1-ium-4-yl]phenyl]phenyl]pyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CC[n+]1ccc(-c2ccc(-c3ccc(-c4cc(-c5ccc(-c6cc[n+](CCP(=O)(O)O)cc6)cc5)nc(-c5ccccc5)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H36N4O6P2/c47-53(48,49)28-26-45-22-18-35(19-23-45)33-8-6-31(7-9-33)32-10-14-37(15-11-32)40-30-41(44-42(43-40)39-4-2-1-3-5-39)38-16-12-34(13-17-38)36-20-24-46(25-21-36)27-29-54(50,51)52/h1-25,30H,26-29H2,(H2-2,47,48,49,50,51,52)/p+2 |
| InChIKey | CISQQLDOCLPKGZ-UHFFFAOYSA-P |
| XLogP | 7.41 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|