C20H23N2O3P+2 — CID 175551397
2-[4-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 175551397) has the molecular formula C20H23N2O3P+2 and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-[4-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | 2-[4-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 175551397 |
| Molecular Formula | C20H23N2O3P+2 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[4-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | CC[n+]1ccc(-c2ccc(-c3cc[n+](CCP(=O)(O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H21N2O3P/c1-2-21-11-7-19(8-12-21)17-3-5-18(6-4-17)20-9-13-22(14-10-20)15-16-26(23,24)25/h3-14H,2,15-16H2,1H3/p+2 |
| InChIKey | KYRZNRUZYAFFMF-UHFFFAOYSA-P |
| XLogP | 2.79 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|