About ethanol;1-ethyl-4-methylpyridin-1-ium
ethanol;1-ethyl-4-methylpyridin-1-ium (PubChem CID 91117915) has the molecular formula C10H18NO+
and a molecular weight of 168.26 g/mol. Its IUPAC name is ethanol;1-ethyl-4-methylpyridin-1-ium.
Molecular Properties
| Compound Name | ethanol;1-ethyl-4-methylpyridin-1-ium |
| PubChem CID | 91117915 |
| Molecular Formula | C10H18NO+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | ethanol;1-ethyl-4-methylpyridin-1-ium |
| SMILES | CCO.CC[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C8H12N.C2H6O/c1-3-9-6-4-8(2)5-7-9;1-2-3/h4-7H,3H2,1-2H3;3H,2H2,1H3/q+1; |
| InChIKey | BKYJBPKFQSBAOS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-ethyl-4-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-ethyl-4-methylpyridin-1-ium?
The IUPAC name of ethanol;1-ethyl-4-methylpyridin-1-ium (CID 91117915) is ethanol;1-ethyl-4-methylpyridin-1-ium.
What is the SMILES notation for ethanol;1-ethyl-4-methylpyridin-1-ium?
The canonical SMILES for ethanol;1-ethyl-4-methylpyridin-1-ium is CCO.CC[n+]1ccc(C)cc1.
What is the InChIKey of ethanol;1-ethyl-4-methylpyridin-1-ium?
The InChIKey is BKYJBPKFQSBAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.C2H6O/c1-3-9-6-4-8(2)5-7-9;1-2-3/h4-7H,3H2,1-2H3;3H,2H2,1H3/q+1;.
What are the key properties of ethanol;1-ethyl-4-methylpyridin-1-ium?
ethanol;1-ethyl-4-methylpyridin-1-ium has a molecular weight of 168.26 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-ethyl-4-methylpyridin-1-ium is sourced from PubChem (CID 91117915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).