C17H20N2O2+2 — CID 18683036
[4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl 2-methylprop-2-enoate (PubChem CID 18683036) has the molecular formula C17H20N2O2+2 and a molecular weight of 284.36 g/mol. Its IUPAC name is [4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18683036 |
| Molecular Formula | C17H20N2O2+2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[n+]1ccc(-c2cc[n+](CC)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-4-18-9-5-15(6-10-18)16-7-11-19(12-8-16)13-21-17(20)14(2)3/h5-12H,2,4,13H2,1,3H3/q+2 |
| InChIKey | HNXBDNJANKFNMX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|