C20H27N2O4+ — CID 18683038
[4-[1-(2-methylprop-2-enoyloxymethyl)pyridin-1-ium-4-yl]piperidin-1-yl]methyl 2-methylprop-2-enoate (PubChem CID 18683038) has the molecular formula C20H27N2O4+ and a molecular weight of 359.45 g/mol. Its IUPAC name is [4-[1-(2-methylprop-2-enoyloxymethyl)pyridin-1-ium-4-yl]piperidin-1-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[1-(2-methylprop-2-enoyloxymethyl)pyridin-1-ium-4-yl]piperidin-1-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18683038 |
| Molecular Formula | C20H27N2O4+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [4-[1-(2-methylprop-2-enoyloxymethyl)pyridin-1-ium-4-yl]piperidin-1-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCN1CCC(c2cc[n+](COC(=O)C(=C)C)cc2)CC1 |
| InChI | InChI=1S/C20H27N2O4/c1-15(2)19(23)25-13-21-9-5-17(6-10-21)18-7-11-22(12-8-18)14-26-20(24)16(3)4/h5-6,9-10,18H,1,3,7-8,11-14H2,2,4H3/q+1 |
| InChIKey | UVRYHADUJLZADJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|