C29H36O4 — CID 118530038
[4-[4-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]methyl]cyclohexyl]phenyl]methyl 2-methylpropanoate (PubChem CID 118530038) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is [4-[4-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]methyl]cyclohexyl]phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-[4-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]methyl]cyclohexyl]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 118530038 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [4-[4-[[4-(2-methylprop-2-enoyloxymethyl)phenyl]methyl]cyclohexyl]phenyl]methyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCc1ccc(CC2CCC(c3ccc(COC(=O)C(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H36O4/c1-20(2)28(30)32-18-24-7-5-22(6-8-24)17-23-9-13-26(14-10-23)27-15-11-25(12-16-27)19-33-29(31)21(3)4/h5-8,11-12,15-16,21,23,26H,1,9-10,13-14,17-19H2,2-4H3 |
| InChIKey | NBOXNJYLMXKYFA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|