About 8-hydroperoxyoctanoic acid
8-hydroperoxyoctanoic acid (PubChem CID 91550474) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 8-hydroperoxyoctanoic acid.
Molecular Properties
| Compound Name | 8-hydroperoxyoctanoic acid |
| PubChem CID | 91550474 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 8-hydroperoxyoctanoic acid |
| SMILES | O=C(O)CCCCCCCOO |
| InChI | InChI=1S/C8H16O4/c9-8(10)6-4-2-1-3-5-7-12-11/h11H,1-7H2,(H,9,10) |
| InChIKey | CAZUPFMKEZOWCD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroperoxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroperoxyoctanoic acid?
The IUPAC name of 8-hydroperoxyoctanoic acid (CID 91550474) is 8-hydroperoxyoctanoic acid.
What is the SMILES notation for 8-hydroperoxyoctanoic acid?
The canonical SMILES for 8-hydroperoxyoctanoic acid is O=C(O)CCCCCCCOO.
What is the InChIKey of 8-hydroperoxyoctanoic acid?
The InChIKey is CAZUPFMKEZOWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c9-8(10)6-4-2-1-3-5-7-12-11/h11H,1-7H2,(H,9,10).
What are the key properties of 8-hydroperoxyoctanoic acid?
8-hydroperoxyoctanoic acid has a molecular weight of 176.21 g/mol, XLogP of 1.90, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroperoxyoctanoic acid is sourced from PubChem (CID 91550474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).