C18H19NO5S — CID 177085655
1-(5-carboxypentyl)-2-methylbenzo[cd]indol-1-ium-6-sulfonate (PubChem CID 177085655) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-2-methylbenzo[cd]indol-1-ium-6-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-2-methylbenzo[cd]indol-1-ium-6-sulfonate |
|---|---|
| PubChem CID | 177085655 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(5-carboxypentyl)-2-methylbenzo[cd]indol-1-ium-6-sulfonate |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)[O-])c3cccc1c23 |
| InChI | InChI=1S/C18H19NO5S/c1-12-13-6-5-7-14-16(25(22,23)24)10-9-15(18(13)14)19(12)11-4-2-3-8-17(20)21/h5-7,9-10H,2-4,8,11H2,1H3,(H-,20,21,22,23,24) |
| InChIKey | LOUIMQPAWXBADO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|