C17H15F3NO2+ — CID 123151853
3-[4-[2-[4-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]propanoic acid (PubChem CID 123151853) has the molecular formula C17H15F3NO2+ and a molecular weight of 322.31 g/mol. Its IUPAC name is 3-[4-[2-[4-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-[2-[4-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 123151853 |
| Molecular Formula | C17H15F3NO2+ |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[4-[2-[4-(trifluoromethyl)phenyl]ethenyl]pyridin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(C=Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)15-5-3-13(4-6-15)1-2-14-7-10-21(11-8-14)12-9-16(22)23/h1-8,10-11H,9,12H2/p+1 |
| InChIKey | KSWOPXDZBYCHOX-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|