C16H11F6N3O — CID 154049346
2,2,2-trifluoro-N-[5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-pyridinyl]acetohydrazide (PubChem CID 154049346) has the molecular formula C16H11F6N3O and a molecular weight of 375.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-pyridinyl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N-[5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-pyridinyl]acetohydrazide |
|---|---|
| PubChem CID | 154049346 |
| Molecular Formula | C16H11F6N3O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-pyridinyl]acetohydrazide |
| SMILES | NN(C(=O)C(F)(F)F)c1ccc(C=Cc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C16H11F6N3O/c17-15(18,19)12-6-3-10(4-7-12)1-2-11-5-8-13(24-9-11)25(23)14(26)16(20,21)22/h1-9H,23H2 |
| InChIKey | IBRNOTKSMQNEHN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|