C9H12OP+ — CID 150471654
(6-ethylidenecyclohexa-2,4-dien-1-yl)-methyl-oxophosphanium (PubChem CID 150471654) has the molecular formula C9H12OP+ and a molecular weight of 167.17 g/mol. Its IUPAC name is (6-ethylidenecyclohexa-2,4-dien-1-yl)-methyl-oxophosphanium.
| Compound Name | (6-ethylidenecyclohexa-2,4-dien-1-yl)-methyl-oxophosphanium |
|---|---|
| PubChem CID | 150471654 |
| Molecular Formula | C9H12OP+ |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (6-ethylidenecyclohexa-2,4-dien-1-yl)-methyl-oxophosphanium |
| SMILES | CC=C1C=CC=CC1[P+](C)=O |
| InChI | InChI=1S/C9H12OP/c1-3-8-6-4-5-7-9(8)11(2)10/h3-7,9H,1-2H3/q+1 |
| InChIKey | WWOUWLPBORGOJL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|