About butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene
butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene (PubChem CID 144672380) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene |
| PubChem CID | 144672380 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene |
| SMILES | C=C(CC)C1=C/C(=C/C)C(C)C=C1.CCCC |
| InChI | InChI=1S/C13H18.C4H10/c1-5-10(3)13-8-7-11(4)12(6-2)9-13;1-3-4-2/h6-9,11H,3,5H2,1-2,4H3;3-4H2,1-2H3/b12-6-; |
| InChIKey | JAODJJUNAZRPGB-DAMYXMBDSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene?
The IUPAC name of butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene (CID 144672380) is butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene.
What is the SMILES notation for butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene?
The canonical SMILES for butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene is C=C(CC)C1=C/C(=C/C)C(C)C=C1.CCCC.
What is the InChIKey of butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene?
The InChIKey is JAODJJUNAZRPGB-DAMYXMBDSA-N. The full InChI is InChI=1S/C13H18.C4H10/c1-5-10(3)13-8-7-11(4)12(6-2)9-13;1-3-4-2/h6-9,11H,3,5H2,1-2,4H3;3-4H2,1-2H3/b12-6-;.
What are the key properties of butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene?
butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene has a molecular weight of 232.41 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(6E)-2-but-1-en-2-yl-6-ethylidene-5-methylcyclohexa-1,3-diene is sourced from PubChem (CID 144672380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).