C23H40O — CID 145271867
butane;ethane;(E)-2-ethenyl-1-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pent-2-en-1-one (PubChem CID 145271867) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is butane;ethane;(E)-2-ethenyl-1-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pent-2-en-1-one.
| Compound Name | butane;ethane;(E)-2-ethenyl-1-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pent-2-en-1-one |
|---|---|
| PubChem CID | 145271867 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | butane;ethane;(E)-2-ethenyl-1-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pent-2-en-1-one |
| SMILES | C=C/C(=C\CC)C(=O)C1=CC2C(C)C2C=C1.CC.CC.CCCC |
| InChI | InChI=1S/C15H18O.C4H10.2C2H6/c1-4-6-11(5-2)15(16)12-7-8-13-10(3)14(13)9-12;1-3-4-2;2*1-2/h5-10,13-14H,2,4H2,1,3H3;3-4H2,1-2H3;2*1-2H3/b11-6+;;; |
| InChIKey | XNSRCTXZTLNNKM-RZWKJUAESA-N |
| XLogP | 7.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|