C10H9ClO2 — CID 163747982
4-prop-2-enoylcyclohexa-1,5-diene-1-carbonyl chloride (PubChem CID 163747982) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 4-prop-2-enoylcyclohexa-1,5-diene-1-carbonyl chloride.
| Compound Name | 4-prop-2-enoylcyclohexa-1,5-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 163747982 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 4-prop-2-enoylcyclohexa-1,5-diene-1-carbonyl chloride |
| SMILES | C=CC(=O)C1C=CC(C(=O)Cl)=CC1 |
| InChI | InChI=1S/C10H9ClO2/c1-2-9(12)7-3-5-8(6-4-7)10(11)13/h2-3,5-7H,1,4H2 |
| InChIKey | LNNXJRDDQVMDEI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|