5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride

C8H8BrClO — CID 123339926

IUPAC5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride
SMILESCC1CC=C(C(=O)Cl)C=C1Br
InChIInChI=1S/C8H8BrClO/c1-5-2-3-6(8(10)11)4-7(5)9/h3-5H,2H2,1H3
InChIKeyQVMOOXREAIDECU-UHFFFAOYSA-N
MW235.51 g/mol
LogP3.00
Rot. Bonds1

About 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride

5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride (PubChem CID 123339926) has the molecular formula C8H8BrClO and a molecular weight of 235.51 g/mol. Its IUPAC name is 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride.

Molecular Properties

Compound Name5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride
PubChem CID123339926
Molecular FormulaC8H8BrClO
Molecular Weight235.51 g/mol
Exact Mass233.94
IUPAC Name5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride
SMILESCC1CC=C(C(=O)Cl)C=C1Br
InChIInChI=1S/C8H8BrClO/c1-5-2-3-6(8(10)11)4-7(5)9/h3-5H,2H2,1H3
InChIKeyQVMOOXREAIDECU-UHFFFAOYSA-N
XLogP3.00
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.51
LogP ≤ 53.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride?
The IUPAC name of 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride (CID 123339926) is 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride.
What is the SMILES notation for 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride?
The canonical SMILES for 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride is CC1CC=C(C(=O)Cl)C=C1Br.
What is the InChIKey of 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride?
The InChIKey is QVMOOXREAIDECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrClO/c1-5-2-3-6(8(10)11)4-7(5)9/h3-5H,2H2,1H3.
What are the key properties of 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride?
5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride has a molecular weight of 235.51 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride is sourced from PubChem (CID 123339926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).