C8H8BrClO — CID 123339926
5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride (PubChem CID 123339926) has the molecular formula C8H8BrClO and a molecular weight of 235.51 g/mol. Its IUPAC name is 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride.
| Compound Name | 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 123339926 |
| Molecular Formula | C8H8BrClO |
| Molecular Weight | 235.51 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 5-bromo-4-methylcyclohexa-1,5-diene-1-carbonyl chloride |
| SMILES | CC1CC=C(C(=O)Cl)C=C1Br |
| InChI | InChI=1S/C8H8BrClO/c1-5-2-3-6(8(10)11)4-7(5)9/h3-5H,2H2,1H3 |
| InChIKey | QVMOOXREAIDECU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|