C15H21BrN2O2 — CID 163980601
N'-[(3-bromo-6-methylcyclohexa-1,3-dien-1-yl)-hydroxymethyl]cyclohexene-1-carbohydrazide (PubChem CID 163980601) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is N'-[(3-bromo-6-methylcyclohexa-1,3-dien-1-yl)-hydroxymethyl]cyclohexene-1-carbohydrazide.
| Compound Name | N'-[(3-bromo-6-methylcyclohexa-1,3-dien-1-yl)-hydroxymethyl]cyclohexene-1-carbohydrazide |
|---|---|
| PubChem CID | 163980601 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N'-[(3-bromo-6-methylcyclohexa-1,3-dien-1-yl)-hydroxymethyl]cyclohexene-1-carbohydrazide |
| SMILES | CC1CC=C(Br)C=C1C(O)NNC(=O)C1=CCCCC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-10-7-8-12(16)9-13(10)15(20)18-17-14(19)11-5-3-2-4-6-11/h5,8-10,15,18,20H,2-4,6-7H2,1H3,(H,17,19) |
| InChIKey | SYAVJEBSYXTNHN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|