C8H13Cl — CID 143462672
4-chloro-1,6-dimethylcyclohexene (PubChem CID 143462672) has the molecular formula C8H13Cl and a molecular weight of 144.64 g/mol. Its IUPAC name is 4-chloro-1,6-dimethylcyclohexene.
| Compound Name | 4-chloro-1,6-dimethylcyclohexene |
|---|---|
| PubChem CID | 143462672 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.64 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 4-chloro-1,6-dimethylcyclohexene |
| SMILES | CC1=CCC(Cl)CC1C |
| InChI | InChI=1S/C8H13Cl/c1-6-3-4-8(9)5-7(6)2/h3,7-8H,4-5H2,1-2H3 |
| InChIKey | XYFZIVYXBWRGFZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|