C8H11NO — CID 163581000
(6S)-1,6-dimethyl-3-nitrosocyclohexa-1,3-diene (PubChem CID 163581000) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (6S)-1,6-dimethyl-3-nitrosocyclohexa-1,3-diene.
| Compound Name | (6S)-1,6-dimethyl-3-nitrosocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163581000 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (6S)-1,6-dimethyl-3-nitrosocyclohexa-1,3-diene |
| SMILES | CC1=CC(N=O)=CC[C@@H]1C |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-8(9-10)5-7(6)2/h4-6H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | GHNLEKABBPRTKP-LURJTMIESA-N |
| XLogP | 2.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |