C11H16 — CID 145266562
(1Z,3Z)-1,5,8-trimethylcycloocta-1,3,5-triene (PubChem CID 145266562) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1Z,3Z)-1,5,8-trimethylcycloocta-1,3,5-triene.
| Compound Name | (1Z,3Z)-1,5,8-trimethylcycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 145266562 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1Z,3Z)-1,5,8-trimethylcycloocta-1,3,5-triene |
| SMILES | CC1=CCC(C)/C(C)=C\C=C/1 |
| InChI | InChI=1S/C11H16/c1-9-5-4-6-10(2)11(3)8-7-9/h4-7,11H,8H2,1-3H3/b5-4-,9-7?,10-6- |
| InChIKey | LTQADRAKNDIFRH-WLVSSHDHSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |