C20H19N — CID 144696503
5-methyl-N,N-diphenylcyclohepta-1,3,5-trien-1-amine (PubChem CID 144696503) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-methyl-N,N-diphenylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 5-methyl-N,N-diphenylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 144696503 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-methyl-N,N-diphenylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CC1=CCC(N(c2ccccc2)c2ccccc2)=CC=C1 |
| InChI | InChI=1S/C20H19N/c1-17-9-8-14-20(16-15-17)21(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15H,16H2,1H3 |
| InChIKey | IYXOSWGUHONIIK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |